•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Aurora Kinase

Set Descending Direction

   

Items 1 to 10 of 22 total

  1. 1
  2. 2
  3. 3
  1. GSK1070916

    CAS No.: 942918-07-2
    Catalog No.: 134938
    Purity: 95%
    MF: C30H33N7O
    MW: 507.642
    Storage: 2-8 degree Celsius
  2. VIC-1911 (TAS-119)

    CAS No.: 1453099-83-6
    Catalog No.: 198481
    Purity: 95%
    MF: C23H22Cl2FN5O3
    MW: 506.365
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C(=O)N2CCC(CC2)(C(=O)O)CC2=NC(=C(C=C2)F)NC2=NNC(=C2)C)C=CC=C1Cl
  3. Aurora kinase inhibitor III

    CAS No.: 879127-16-9
    Catalog No.: ZB1600
    Purity: 95%
    MF: C21H18F3N5O
    MW: 413.403
    Storage: 2-8 degree Celsius
    SMILES: FC(C=1C=C(C=CC1)NC1=NC(=NC=C1)NC=1C=C(C=CC1)NC(=O)C1CC1)(F)F
  4. tert-butyl 4-((5-aminopyridin-2-yl)oxy)piperidine-1-carboxylate

    CAS No.: 346665-41-6
    Catalog No.: 187217
    Purity: 95%
    MF: C15H23N3O3
    MW: 293.367
    Storage: 2-8 degree Celsius
    SMILES: NC=1C=CC(=NC1)OC1CCN(CC1)C(=O)OC(C)(C)C
  5. AZD1152-HQPA; Barasertib-HQPA; INH-34

    CAS No.: 722544-51-6
    Catalog No.: 185107
    Purity: 95%
    MF: C26H30FN7O3
    MW: 507.57
    Storage: 2-8 degree Celsius
    SMILES: CCN(CCO)CCCOC1=CC=C2C(NC3=CC(CC(=O)NC4=CC(F)=CC=C4)=NN3)=NC=NC2=C1
  6. MK-5108; VX-689

    CAS No.: 1010085-13-8
    Catalog No.: 151768
    Purity: 95%
    MF: C22H21ClFN3O3S
    MW: 461.946
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)[C@@]1(CC2=NC(NC3=NC=CS3)=CC=C2)CC[C@@H](CC1)OC1=C(F)C(Cl)=CC=C1
  7. ZM 447439

    CAS No.: 331771-20-1
    Catalog No.: 141349
    Purity: 95%
    MF: C29H31N5O4
    MW: 513.598
    Storage: 2-8 degree Celsius
    SMILES: COC1=C(OCCCN2CCOCC2)C=C2N=CN=C(NC3=CC=C(NC(=O)C4=CC=CC=C4)C=C3)C2=C1
  8. SNS-314 Mesylate

    CAS No.: 1146618-41-8
    Catalog No.: 141354
    Purity: 95%
    MF: C19H19ClN6O4S3
    MW: 527.053
    Storage: 2-8 degree Celsius
    SMILES: CS(O)(=O)=O.ClC1=CC(NC(=O)NC2=NC=C(CCNC3=C4SC=CC4=NC=N3)S2)=CC=C1
  9. PF-03814735

    CAS No.: 942487-16-3
    Catalog No.: 141612
    Purity: 95%
    MF: C23H25F3N6O2
    MW: 474.487
    Storage: 2-8 degree Celsius
    SMILES: [H][C@@]12CC[C@@]([H])(N1C(=O)CNC(C)=O)C1=C2C=CC(NC2=NC=C(C(NC3CCC3)=N2)C(F)(F)F)=C1
  10. MLN8054

    CAS No.: 869363-13-3
    Catalog No.: 141348
    Purity: 95%
    MF: C25H15ClF2N4O2
    MW: 476.87
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C1=CC=C(NC2=NC=C3CN=C(C4=CC(Cl)=CC=C4C3=N2)C2=C(F)C=CC=C2F)C=C1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 22 total

  1. 1
  2. 2
  3. 3