•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Aryls

Set Ascending Direction

   

Items 21 to 30 of 7305 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. (S)-Benzyl tert-butyl (3,3-dimethylbutane-1,2-diyl)dicarbamate

    CAS No.: 1374635-44-5
    Catalog No.: 193089
    Purity: 95%
    MF: C19H30N2O4
    MW: 350.459
    Storage: 2-8 degree Celsius
    SMILES: CC([C@@H](CNC(OCC1=CC=CC=C1)=O)NC(OC(C)(C)C)=O)(C)C
  2. tert-butyl 3-methyl-4-nitrophenylcarbamate

    CAS No.: 1380445-45-3
    Catalog No.: 193090
    Purity: 95%
    MF: C12H16N2O4
    MW: 252.27
    Storage: 2-8 degree Celsius
    SMILES: CC=1C=C(C=CC1[N+](=O)[O-])NC(OC(C)(C)C)=O
  3. (S)-3-(1-aminoethyl)benzoic acid hydrochloride

    CAS No.: 1391458-02-8
    Catalog No.: 193091
    Purity: 95%
    MF: C9H12ClNO2
    MW: 201.653
    Storage: 2-8 degree Celsius
    SMILES: Cl.N[C@@H](C)C=1C=C(C(=O)O)C=CC1
  4. tert-butyl 3-methyl-2-nitrophenylcarbamate

    CAS No.: 1392274-11-1
    Catalog No.: 193092
    Purity: 95%
    MF: C12H16N2O4
    MW: 252.27
    Storage: 2-8 degree Celsius
    SMILES: CC=1C(=C(C=CC1)NC(OC(C)(C)C)=O)[N+](=O)[O-]
  5. (R)-benzyl but-3-yn-2-ylcarbamate

    CAS No.: 1393524-11-2
    Catalog No.: 193093
    Purity: 95%
    MF: C12H13NO2
    MW: 203.241
    Storage: 2-8 degree Celsius
    SMILES: C[C@H](C#C)NC(OCC1=CC=CC=C1)=O
  6. benzyl but-3-yn-2-ylcarbamate

    CAS No.: 1393576-61-8
    Catalog No.: 193094
    Purity: 95%
    MF: C12H13NO2
    MW: 203.241
    Storage: 2-8 degree Celsius
    SMILES: CC(C#C)NC(OCC1=CC=CC=C1)=O
  7. 2-(4-(benzyloxy)styryl)-6-hydroxybenzoic acid

    CAS No.: 148324-47-4
    Catalog No.: 193097
    Purity: 95%
    MF: C22H18O4
    MW: 346.382
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)OC1=CC=C(C=CC2=C(C(=O)O)C(=CC=C2)O)C=C1
  8. methyl 6-amino-2-methoxynicotinate

    CAS No.: 149539-81-1
    Catalog No.: 193098
    Purity: 95%
    MF: C8H10N2O3
    MW: 182.179
    Storage: 2-8 degree Celsius
    SMILES: NC1=NC(=C(C(=O)OC)C=C1)OC
  9. ethyl 3-(2,3-dichlorophenyl)acrylate

    CAS No.: 154238-78-5
    Catalog No.: 193099
    Purity: 95%
    MF: C11H10Cl2O2
    MW: 245.105
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C=CC=C1Cl)C=CC(=O)OCC
  10. 3-(1-aminoethyl)benzoic acid hydrochloride

    CAS No.: 165949-85-9
    Catalog No.: 193102
    Purity: 95%
    MF: C9H12ClNO2
    MW: 201.653
    Storage: 2-8 degree Celsius
    SMILES: Cl.NC(C)C=1C=C(C(=O)O)C=CC1
Loading ...Load More ...
Set Ascending Direction

   

Items 21 to 30 of 7305 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5