•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Aryls

Set Descending Direction

   

Items 1 to 10 of 24340 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. methyl 3-bromo-5-(hydroxymethyl)benzoate

    CAS No.: 307353-32-8
    Catalog No.: 126737
    Purity: 95%
    MF: C9H9BrO3
    MW: 245.072
    Storage: 2-8 degree Celsius
    SMILES: COC(=O)C1=CC(CO)=CC(Br)=C1
  2. 3-(4-bromophenyl)-3-(trifluoromethyl)-3H-diazirine

    CAS No.: 952143-02-1
    Catalog No.: TQ0144
    Purity: 95%
    MF: C8H4BrF3N2
    MW: 265.032
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=C(C=C1)C1(N=N1)C(F)(F)F
  3. 3,5-dimethyl-2-iodophenol

    CAS No.: 24242-79-3
    Catalog No.: HKP0195
    Purity: 95%
    MF: C8H9IO
    MW: 248.063
    Storage: 2-8 degree Celsius
    SMILES: CC=1C(=C(C=C(C1)C)O)I
  4. 2-(2-bromo-6-nitrophenyl)ethanol

    CAS No.: 118665-02-4
    Catalog No.: 100114
    Purity: 95%
    MF: C8H8BrNO3
    MW: 246.06
    Storage: 2-8 degree Celsius
    SMILES: OCCC1=C(C=CC=C1Br)[N+]([O-])=O
  5. (2-bromo-6-nitrophenethoxy)(tert-butyl)dimethylsilane

    CAS No.: 1227958-15-7
    Catalog No.: 100115
    Purity: 95%
    MF: C14H22BrNO3Si
    MW: 360.324
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)[Si](C)(C)OCCC1=C(C=CC=C1Br)[N+]([O-])=O
  6. 3-bromo-2-(2-((tert-butyldimethylsilyl)oxy)ethyl)aniline

    CAS No.: 1227958-06-6
    Catalog No.: 100116
    Purity: 95%
    MF: C14H24BrNOSi
    MW: 330.342
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)[Si](C)(C)OCCC1=C(Br)C=CC=C1N
  7. 2-bromo-6-nitrobenzaldehyde

    CAS No.: 20357-21-5
    Catalog No.: 100117
    Purity: 95%
    MF: C7H4BrNO3
    MW: 230.017
    Storage: 2-8 degree Celsius
    SMILES: [O-][N+](=O)C1=C(C=O)C(Br)=CC=C1
  8. 2-bromo-6-nitrophenylmethanol

    CAS No.: 861106-91-4
    Catalog No.: 100118
    Purity: 95%
    MF: C7H6BrNO3
    MW: 232.033
    Storage: 2-8 degree Celsius
    SMILES: OCC1=C(C=CC=C1Br)[N+]([O-])=O
  9. (2-bromo-6-nitrobenzyloxy)(tert-butyl)dimethylsilane

    CAS No.: 1147531-02-9
    Catalog No.: 100119
    Purity: 95%
    MF: C13H20BrNO3Si
    MW: 346.297
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)[Si](C)(C)OCC1=C(C=CC=C1Br)[N+]([O-])=O
  10. 3-bromo-4-(dimethylamino)benzaldehyde

    CAS No.: 56479-63-1
    Catalog No.: 100120
    Purity: 95%
    MF: C9H10BrNO
    MW: 228.089
    Storage: 2-8 degree Celsius
    SMILES: CN(C)C1=CC=C(C=O)C=C1Br
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 24340 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5