•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Apoptosis

Set Descending Direction

   

Items 1 to 10 of 124 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. Belnacasan; VX-765; VX765

    CAS No.: 273404-37-8
    Catalog No.: 100660
    Purity: 95%
    MF: C24H33ClN4O6
    MW: 509.003
    Storage: 2-8 degree Celsius
  2. CID-2011756; CID 2011756

    CAS No.: 638156-11-3
    Catalog No.: 100834
    Purity: 95%
    MF: C22H21ClN2O3
    MW: 396.874
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC(=CC=C1)C1=CC=C(O1)C(=O)NC1=CC=C(CN2CCOCC2)C=C1
  3. kb NB 142-70; kb-NB142-70

    CAS No.: 1233533-04-4
    Catalog No.: 100774
    Purity: 95%
    MF: C11H9NO2S2
    MW: 251.332
    Storage: 2-8 degree Celsius
  4. AT-406

    CAS No.: 1071992-99-8
    Catalog No.: 101141
    Purity: 95%
    MF: C32H43N5O4
    MW: 561.727
    Storage: 2-8 degree Celsius
    SMILES: [H][C@]12CC[C@H](N1C(=O)[C@H](CN(CC2)C(=O)CC(C)C)NC(=O)[C@H](C)NC)C(=O)NC(C1=CC=CC=C1)C1=CC=CC=C1
  5. RITA; NSC 652287

    CAS No.: 213261-59-7
    Catalog No.: 101603
    Purity: 95%
    MF: C14H12O3S2
    MW: 292.381
    Storage: 2-8 degree Celsius
    SMILES: OCC1=CC=C(S1)C1=CC=C(O1)C1=CC=C(CO)S1
  6. Pifithrin-.alpha.; PFT.alpha.

    CAS No.: 63208-82-2
    Catalog No.: 101862
    Purity: 95%
    MF: C16H19BrN2OS
    MW: 367.312
    Storage: 2-8 degree Celsius
    SMILES: Br[H].CC1=CC=C(C=C1)C(=O)CN1C(=N)SC2=C1CCCC2
  7. Tasisulam; LY573636

    CAS No.: 519055-62-0
    Catalog No.: 104823
    Purity: 95%
    MF: C11H6BrCl2NO3S2
    MW: 415.117
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=C(C(=O)NS(=O)(=O)C2=CC=C(Br)S2)C(Cl)=C1
  8. Venetoclax; ABT-199; ABT 199; GDC-0199

    CAS No.: 1257044-40-8
    Catalog No.: 105148
    Purity: 95%
    MF: C45H50ClN7O7S
    MW: 868.457
    Storage: 2-8 degree Celsius
    SMILES: CC1(C)CCC(CN2CCN(CC2)C2=CC=C(C(=O)NS(=O)(=O)C3=CC=C(NCC4CCOCC4)C(=C3)[N+]([O-])=O)C(OC3=CN=C4NC=CC4=C3)=C2)=C(C1)C1=CC=C(Cl)C=C1
  9. Navitoclax; ABT-263

    CAS No.: 923564-51-6
    Catalog No.: 105149
    Purity: 95%
    MF: C47H55ClF3N5O6S3
    MW: 974.634
    Storage: 2-8 degree Celsius
  10. Obatoclax Mesylate; GX15-070

    CAS No.: 803712-79-0
    Catalog No.: 104795
    Purity: 95%
    MF: C21H23N3O4S
    MW: 413.499
    Storage: 2-8 degree Celsius
    SMILES: CS(O)(=O)=O.COC1=CC(=N\C1=C/C1=C(C)C=C(C)N1)C1=CC2=C(N1)C=CC=C2
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 124 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5