•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Antibacterial

Set Descending Direction

   

Items 1 to 10 of 37 total

  1. 1
  2. 2
  3. 3
  4. 4
  1. β-Lactamase-IN-2

    CAS No.: 2114651-20-4
    Catalog No.: WLZ0208
    Purity: 95%
    MF: C11H9FO3
    MW: 208.188
    Storage: 2-8 degree Celsius
    SMILES: FC1=C(C2=C(C=CO2)C=C1)C(=O)OCC
  2. Delpazolid

    CAS No.: 1219707-39-7
    Catalog No.: 186355
    Purity: 95%
    MF: C14H17FN4O3
    MW: 308.313
    Storage: 2-8 degree Celsius
    SMILES: FC=1C=C(C=CC1N1C=NN(CC1)C)N1C(O[C@H](C1)CO)=O
  3. Lascufloxacin; KRP-AM1977X

    CAS No.: 848416-07-9
    Catalog No.: 193759
    Purity: 95%
    MF: C21H24F3N3O4
    MW: 439.434
    Storage: 2-8 degree Celsius
    SMILES: C1(CC1)NC[C@H]1CN(C[C@H]1F)C1=C(C=C2C(C(=CN(C2=C1OC)CCF)C(=O)O)=O)F
  4. GW779439X

    CAS No.: 551919-98-3
    Catalog No.: 194586
    Purity: 95%
    MF: C22H21F3N8
    MW: 454.46
    Storage: 2-8 degree Celsius
    SMILES: CN1CCN(CC1)C1=C(C=C(C=C1)NC1=NC=CC(=N1)C=1C=NN2N=CC=CC21)C(F)(F)F
  5. Ribocil

    CAS No.: 1381289-58-2
    Catalog No.: 194646
    Purity: 95%
    MF: C19H22N6OS
    MW: 382.493
    Storage: 2-8 degree Celsius
    SMILES: CNC1=NC=C(C=N1)CN1CC(CCC1)C1=NC(=CC(N1)=O)C=1SC=CC1
  6. Afabicin

    CAS No.: 1518800-35-5
    Catalog No.: 194783
    Purity: 95%
    MF: C23H24N3O7P
    MW: 485.433
    Storage: 2-8 degree Celsius
    SMILES: P(=O)(OCN1C(CCC2=CC(=CN=C12)\C=C\C(=O)N(CC=1OC2=C(C1C)C=CC=C2)C)=O)(O)O
  7. KKL-35

    CAS No.: 865285-29-6
    Catalog No.: WLZ0017
    Purity: 95%
    MF: C15H9ClFN3O2
    MW: 317.707
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=C(C(=O)NC=2OC(=NN2)C2=CC=C(C=C2)F)C=C1
  8. Qstatin

    CAS No.: 902688-24-8
    Catalog No.: WLZ0038
    Purity: 95%
    MF: C7H5BrN2O2S2
    MW: 293.167
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=C(S1)S(=O)(=O)N1N=CC=C1
  9. Filastatin

    CAS No.: 431996-53-1
    Catalog No.: WLZ0126
    Purity: 95%
    MF: C18H18ClN3O3
    MW: 359.813
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=C(C=CC1C)C(=O)N1CCN(CC1)C1=CC=C(C=C1)[N+](=O)[O-]
  10. Fosravuconazole L-lysine ethanolate

    CAS No.: 914361-45-8
    Catalog No.: WLZ0199
    Purity: 95%
    MF: C31H40F2N7O8PS
    MW: 739.739
    Storage: 2-8 degree Celsius
    SMILES: C(C)O.FC1=C(C=CC(=C1)F)[C@]([C@@H](C)C=1SC=C(N1)C1=CC=C(C#N)C=C1)(CN1N=CN=C1)OCOP(=O)(O)O.N[C@@H](CCCCN)C(=O)O
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 37 total

  1. 1
  2. 2
  3. 3
  4. 4