•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Anthracenes

Set Descending Direction

   

Items 41 to 50 of 87 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7
  1. anthracene-9-carboxylic acid

    CAS No.: 723-62-6
    Catalog No.: 194984
    Purity: 95%
    MF: C15H10O2
    MW: 222.243
    Storage: 2-8 degree Celsius
    SMILES: C1=CC=CC2=CC3=CC=CC=C3C(=C12)C(=O)O
  2. 1-(anthracen-9-yl)ethan-1-one

    CAS No.: 784-04-3
    Catalog No.: 194198
    Purity: 95%
    MF: C16H12O
    MW: 220.271
    Storage: 2-8 degree Celsius
    SMILES: C1=CC=CC2=CC3=CC=CC=C3C(=C12)C(C)=O
  3. (1S)-1-(2-anthryl)propylamine

    CAS No.: 1213936-15-2
    Catalog No.: 190032
    Purity: 95%
    MF: C17H17N
    MW: 235.33
    Storage: 2-8 degree Celsius
    SMILES: C1=C(C=CC2=CC3=CC=CC=C3C=C12)[C@H](CC)N
  4. (2R)-2-amino-2-(2-anthryl)ethan-1-ol

    CAS No.: 1213907-08-4
    Catalog No.: 190031
    Purity: 95%
    MF: C16H15NO
    MW: 237.302
    Storage: 2-8 degree Celsius
    SMILES: N[C@@H](CO)C1=CC2=CC3=CC=CC=C3C=C2C=C1
  5. 2-anthraceneboronic acid

    CAS No.: 141981-64-8
    Catalog No.: 110413
    Purity: 95%
    MF: C14H11BO2
    MW: 222.052
    Storage: 2-8 degree Celsius
  6. 9-bromoanthracene

    CAS No.: 1564-64-3
    Catalog No.: 140005
    Purity: 95%
    MF: C14H9Br
    MW: 257.13
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C2C=CC=CC2=CC2=CC=CC=C12
  7. 9,10-dihydro-9,10-(methanoiminomethano)anthracene

    CAS No.: 24686-27-9
    Catalog No.: 139561
    Purity: 95%
    MF: C16H15N
    MW: 221.303
    Storage: 2-8 degree Celsius
    SMILES: C1NCC2C3=CC=CC=C3C1C1=C2C=CC=C1
  8. sodium 1-amino-4-((4-chlorophenyl)amino)-9,10-dioxo-9,10-dihydroanthracene-2-sulfonate

    CAS No.: 78510-31-3
    Catalog No.: 138255
    Purity: 95%
    MF: C20H12ClN2NaO5S
    MW: 450.835
    Storage: 2-8 degree Celsius
  9. 1H-naphtho[2,3-f]isoindole-1,3(2H)-dione

    CAS No.: 6705-69-7
    Catalog No.: 135437
    Purity: 95%
    MF: C16H9NO2
    MW: 247.253
    Storage: 2-8 degree Celsius
  10. (1R,2R)-2-(1,3-dioxo-1H-naphtho[2,3-f]isoindol-2(3H)-yl)cyclohexanecarboxylic acid

    CAS No.: 446044-44-6
    Catalog No.: 135428
    Purity: 95%
    MF: C23H19NO4
    MW: 373.408
    Storage: 2-8 degree Celsius
Loading ...Load More ...
Set Descending Direction

   

Items 41 to 50 of 87 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7