•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Anthracenes

Set Descending Direction

   

Items 11 to 20 of 87 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. anthracene-9,10-dicarbaldehyde

    CAS No.: 7044-91-9
    Catalog No.: 177957
    Purity: 95%
    MF: C16H10O2
    MW: 234.254
    Storage: 2-8 degree Celsius
    SMILES: O=CC1=C2C=CC=CC2=C(C=O)C2=CC=CC=C12
  2. (1S)-1-(2-anthryl)prop-2-enylamine

    CAS No.: 1213903-79-7
    Catalog No.: 190030
    Purity: 95%
    MF: C17H15N
    MW: 233.314
    Storage: 2-8 degree Celsius
    SMILES: C1=C(C=CC2=CC3=CC=CC=C3C=C12)[C@H](C=C)N
  3. 2-chloroanthracene

    CAS No.: 17135-78-3
    Catalog No.: 177830
    Purity: 95%
    MF: C14H9Cl
    MW: 212.679
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC2=CC3=CC=CC=C3C=C2C=C1
  4. 1,2-dimethoxyanthracene-9,10-dione

    CAS No.: 6003-12-9
    Catalog No.: 172162
    Purity: 95%
    MF: C16H12O4
    MW: 268.268
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC=C2C(=O)C3=CC=CC=C3C(=O)C2=C1OC
  5. 1-amino-4-bromo-9,10-dioxo-9,10-dihydroanthracene-2-sulfonic acid

    CAS No.: 116-81-4
    Catalog No.: 166205
    Purity: 95%
    MF: C14H8BrNO5S
    MW: 382.191
    Storage: 2-8 degree Celsius
    SMILES: NC1=C2C(=O)C3=CC=CC=C3C(=O)C2=C(Br)C=C1S(O)(=O)=O
  6. 9,10-dioxo-9,10-dihydroanthracene-2,6-dicarboxylic acid

    CAS No.: 42946-19-0
    Catalog No.: 162238
    Purity: 95%
    MF: C16H8O6
    MW: 296.234
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C1=CC=C2C(=O)C3=CC(=CC=C3C(=O)C2=C1)C(O)=O
  7. anthracene-2,6-dicarboxylic acid

    CAS No.: 138308-89-1
    Catalog No.: 162215
    Purity: 95%
    MF: C16H10O4
    MW: 266.252
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C1=CC2=CC3=CC=C(C=C3C=C2C=C1)C(O)=O
  8. 2,6-di-tert-butylanthracene

    CAS No.: 62375-58-0
    Catalog No.: 155376
    Purity: 95%
    MF: C22H26
    MW: 290.45
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)C1=CC2=CC3=CC=C(C=C3C=C2C=C1)C(C)(C)C
  9. 2-(10-bromoanthracen-9-yl)thiophene

    CAS No.: 689254-82-8
    Catalog No.: 183830
    Purity: 95%
    MF: C18H11BrS
    MW: 339.257
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C2C=CC=CC2=C(C2=CC=CS2)C2=CC=CC=C12
  10. anthracen-2-ylmethanol

    CAS No.: 22863-82-7
    Catalog No.: 150990
    Purity: 95%
    MF: C15H12O
    MW: 208.26
    Storage: 2-8 degree Celsius
    SMILES: OCC1=CC2=CC3=CC=CC=C3C=C2C=C1
Loading ...Load More ...
Set Descending Direction

   

Items 11 to 20 of 87 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5