•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Anthracenes

Set Descending Direction

   

Items 1 to 10 of 87 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 2,6-dibromoanthracene

    CAS No.: 186517-01-1
    Catalog No.: 177838
    Purity: 95%
    MF: C14H8Br2
    MW: 336.026
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC2=CC3=CC=C(Br)C=C3C=C2C=C1
  2. (1S)-1-(2-anthryl)-2-methylpropylamine

    CAS No.: 1213675-27-4
    Catalog No.: 190029
    Purity: 95%
    MF: C18H19N
    MW: 249.357
    Storage: 2-8 degree Celsius
    SMILES: C1=C(C=CC2=CC3=CC=CC=C3C=C12)[C@H](C(C)C)N
  3. (2S)-2-amino-2-(2-anthryl)ethan-1-ol

    CAS No.: 1213581-06-6
    Catalog No.: 190028
    Purity: 95%
    MF: C16H15NO
    MW: 237.302
    Storage: 2-8 degree Celsius
    SMILES: N[C@H](CO)C1=CC2=CC3=CC=CC=C3C=C2C=C1
  4. ((1R)-1-(2-anthryl)ethyl)methylamine

    CAS No.: 1213531-00-0
    Catalog No.: 190027
    Purity: 95%
    MF: C17H17N
    MW: 235.33
    Storage: 2-8 degree Celsius
    SMILES: C1=C(C=CC2=CC3=CC=CC=C3C=C12)[C@@H](C)NC
  5. ((1S)-1-(2-anthryl)ethyl)methylamine

    CAS No.: 1213468-84-8
    Catalog No.: 190026
    Purity: 95%
    MF: C17H17N
    MW: 235.33
    Storage: 2-8 degree Celsius
    SMILES: C1=C(C=CC2=CC3=CC=CC=C3C=C12)[C@H](C)NC
  6. (1R)-1-(2-anthryl)butylamine

    CAS No.: 1213461-50-7
    Catalog No.: 190025
    Purity: 95%
    MF: C18H19N
    MW: 249.357
    Storage: 2-8 degree Celsius
    SMILES: C1=C(C=CC2=CC3=CC=CC=C3C=C12)[C@@H](CCC)N
  7. (1R)-1-(2-anthryl)prop-2-enylamine

    CAS No.: 1213376-01-2
    Catalog No.: 190024
    Purity: 95%
    MF: C17H15N
    MW: 233.314
    Storage: 2-8 degree Celsius
    SMILES: C1=C(C=CC2=CC3=CC=CC=C3C=C12)[C@@H](C=C)N
  8. (1R)-1-(2-anthryl)-2-methylpropylamine

    CAS No.: 1213343-74-8
    Catalog No.: 190023
    Purity: 95%
    MF: C18H19N
    MW: 249.357
    Storage: 2-8 degree Celsius
    SMILES: C1=C(C=CC2=CC3=CC=CC=C3C=C12)[C@@H](C(C)C)N
  9. (1R)-1-(2-anthryl)propylamine

    CAS No.: 1213186-85-6
    Catalog No.: 190022
    Purity: 95%
    MF: C17H17N
    MW: 235.33
    Storage: 2-8 degree Celsius
    SMILES: C1=C(C=CC2=CC3=CC=CC=C3C=C12)[C@@H](CC)N
  10. 1-bromo-3-chloro-5-(isothiocyanatomethyl)benzene

    CAS No.: NA
    Catalog No.: 184315
    Purity: 95%
    MF: C8H5BrClNS
    MW: 262.559
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC(CN=C=S)=CC(Br)=C1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 87 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5