•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Anthracenes

Set Ascending Direction

   

Items 21 to 30 of 87 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 9,10-dioxo-8a,9,10,10a-tetrahydroanthracene-2-carboxylic acid

    CAS No.: 117-78-2
    Catalog No.: 150989
    Purity: 95%
    MF: C15H10O4
    MW: 254.241
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C1=CC=C2C(=O)C3C=CC=CC3C(=O)C2=C1
  2. 1-amino-5,8-dihydroxy-4-(2-(2-hydroxyethylamino)ethylamino)anthracene-9,10-dione

    CAS No.: 89991-52-6
    Catalog No.: 161359
    Purity: 95%
    MF: C18H19N3O5
    MW: 357.366
    Storage: 2-8 degree Celsius
    SMILES: NC1=C2C(=O)C3=C(O)C=CC(O)=C3C(=O)C2=C(NCCNCCO)C=C1
  3. 1,8-dihydroxy-4,5-dinitro-9,10-dihydroanthracene-9,10-dione

    CAS No.: 81-55-0
    Catalog No.: 155203
    Purity: 95%
    MF: C14H6N2O8
    MW: 330.208
    Storage: 2-8 degree Celsius
    SMILES: OC1=CC=C(C2=C1C(=O)C1=C(O)C=CC(=C1C2=O)[N+]([O-])=O)[N+]([O-])=O
  4. (1R,4S,4aR,9aS)-rel-1,4,4a,9a-tetrahydro-4a-methyl-1,4-methanoanthracene-9,10-dione

    CAS No.: 97804-50-7
    Catalog No.: 197248
    Purity: 95%
    MF: C16H14O2
    MW: 238.286
    Storage: 2-8 degree Celsius
    SMILES: C[C@]12[C@@H]3C=C[C@H]([C@@H]2C(C2=CC=CC=C2C1=O)=O)C3
  5. anthracene-9,10-dicarbonitrile

    CAS No.: 1217-45-4
    Catalog No.: 197205
    Purity: 95%
    MF: C16H8N2
    MW: 228.254
    Storage: 2-8 degree Celsius
    SMILES: C1=CC=CC2=C(C3=CC=CC=C3C(=C12)C#N)C#N
  6. anthracene-2,6-dicarbaldehyde

    CAS No.: 1262433-90-8
    Catalog No.: ZB1939
    Purity: 95%
    MF: C16H10O2
    MW: 234.254
    Storage: 2-8 degree Celsius
    SMILES: C1=C(C=CC2=CC3=CC(=CC=C3C=C12)C=O)C=O
  7. phenanthrene-4,5-dicarboxylic acid

    CAS No.: 5462-82-8
    Catalog No.: 194879
    Purity: 95%
    MF: C16H10O4
    MW: 266.252
    Storage: 2-8 degree Celsius
    SMILES: C1=CC=C(C2=C3C(=CC=CC3=CC=C12)C(=O)O)C(=O)O
  8. 9,10-dibromo-2,6-di-tert-butylanthracene

    CAS No.: 332083-45-1
    Catalog No.: 178849
    Purity: 95%
    MF: C22H24Br2
    MW: 448.242
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)C1=CC2=C(Br)C3=CC=C(C=C3C(Br)=C2C=C1)C(C)(C)C
  9. 1,8-dichloro-9,10-bis(phenylethynyl) anthracene

    CAS No.: 51749-83-8
    Catalog No.: 177202
    Purity: 95%
    MF: C30H16Cl2
    MW: 447.364
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=CC2=C(C#CC3=CC=CC=C3)C3=CC=CC(Cl)=C3C(C#CC3=CC=CC=C3)=C12
  10. 9,9,10,10-tetramethyl-9,10-dihydroanthracene

    CAS No.: 24269-10-1
    Catalog No.: 159673
    Purity: 95%
    MF: C18H20
    MW: 236.358
    Storage: 2-8 degree Celsius
    SMILES: CC1(C)C2=CC=CC=C2C(C)(C)C2=CC=CC=C12
Loading ...Load More ...
Set Ascending Direction

   

Items 21 to 30 of 87 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5