•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Anthracenes

Set Ascending Direction

   

Items 1 to 10 of 21 total

  1. 1
  2. 2
  3. 3
  1. anthracene-9-carboxylic acid

    CAS No.: 723-62-6
    Catalog No.: 194984
    Purity: 95%
    MF: C15H10O2
    MW: 222.243
    Storage: 2-8 degree Celsius
    SMILES: C1=CC=CC2=CC3=CC=CC=C3C(=C12)C(=O)O
  2. anthracene-2-carboxylic acid

    CAS No.: 613-08-1
    Catalog No.: 108140
    Purity: 95%
    MF: C15H10O2
    MW: 222.243
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C1=CC=C2C=C3C=CC=CC3=CC2=C1
  3. 2-(10-bromoanthracen-9-yl)thiophene

    CAS No.: 689254-82-8
    Catalog No.: 183830
    Purity: 95%
    MF: C18H11BrS
    MW: 339.257
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C2C=CC=CC2=C(C2=CC=CS2)C2=CC=CC=C12
  4. anthracen-2-ylmethanol

    CAS No.: 22863-82-7
    Catalog No.: 150990
    Purity: 95%
    MF: C15H12O
    MW: 208.26
    Storage: 2-8 degree Celsius
    SMILES: OCC1=CC2=CC3=CC=CC=C3C=C2C=C1
  5. 9,10-dioxo-8a,9,10,10a-tetrahydroanthracene-2-carboxylic acid

    CAS No.: 117-78-2
    Catalog No.: 150989
    Purity: 95%
    MF: C15H10O4
    MW: 254.241
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C1=CC=C2C(=O)C3C=CC=CC3C(=O)C2=C1
  6. anthracene-2-carbaldehyde

    CAS No.: 2143-81-9
    Catalog No.: 135417
    Purity: 95%
    MF: C15H10O
    MW: 206.244
    Storage: 2-8 degree Celsius
    SMILES: O=CC1=CC2=CC3=CC=CC=C3C=C2C=C1
  7. sodium 1-amino-4-((4-chlorophenyl)amino)-9,10-dioxo-9,10-dihydroanthracene-2-sulfonate

    CAS No.: 78510-31-3
    Catalog No.: 138255
    Purity: 95%
    MF: C20H12ClN2NaO5S
    MW: 450.835
    Storage: 2-8 degree Celsius
    SMILES: [Na+].NC1=C2C(=O)C3=C(C=CC=C3)C(=O)C2=C(NC2=CC=C(Cl)C=C2)C=C1S([O-])(=O)=O
  8. 1-bromo-3-chloro-5-(isothiocyanatomethyl)benzene

    CAS No.: NA
    Catalog No.: 184315
    Purity: 95%
    MF: C8H5BrClNS
    MW: 262.559
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC(CN=C=S)=CC(Br)=C1
  9. anthracene-1,4-dione

    CAS No.: 635-12-1
    Catalog No.: 102225
    Purity: 95%
    MF: C14H8O2
    MW: 208.216
    Storage: 2-8 degree Celsius
    SMILES: O=C1C=CC(=O)C2=C1C=C1C=CC=CC1=C2
  10. 9-anthracenemethanol

    CAS No.: 1468-95-7
    Catalog No.: 101725
    Purity: 95%
    MF: C15H12O
    MW: 208.26
    Storage: 2-8 degree Celsius
    SMILES: OCC1=C2C=CC=CC2=CC2=CC=CC=C12
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 21 total

  1. 1
  2. 2
  3. 3