•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Angiogenesis

Set Descending Direction

   

Items 1 to 10 of 87 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. Verteporfin

    CAS No.: 129497-78-5
    Catalog No.: 140567
    Purity: 95%
    MF: C41H44N4O9
    MW: 736.822
    Storage: 2-8 degree Celsius
    SMILES: CO.COC(=O)[C@@H]1C(=CC=C2C3=N\C(=C/C4=C(C)C(CCC(O)=O)=C(N4)\C=C4/N=C(/C=C5\N/C(=C\3)C(C)=C5C=C)C(C)=C4CCC(O)=O)\[C@]12C)C(=O)OC
  2. G-749

    CAS No.: 1457983-28-6
    Catalog No.: 152021
    Purity: 95%
    MF: C25H25BrN6O2
    MW: 521.419
    Storage: 2-8 degree Celsius
    SMILES: CN1CCC(CC1)NC1=NC(NC2=CC=C(OC3=CC=CC=C3)C=C2)=C2C(=O)NC=C(Br)C2=N1
  3. FG-2216

    CAS No.: 223387-75-5
    Catalog No.: 152140
    Purity: 95%
    MF: C12H9ClN2O4
    MW: 280.667
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)CNC(=O)C1=C(O)C2=CC=CC=C2C(Cl)=N1
  4. ENMD-2076 L-(+)-Tartaric acid

    CAS No.: 1453868-32-0
    Catalog No.: 151556
    Purity: 95%
    MF: C25H31N7O6
    MW: 525.566
    Storage: 2-8 degree Celsius
    SMILES: O[C@H]([C@@H](O)C(O)=O)C(O)=O.CN1CCN(CC1)C1=CC(NC2=NNC(C)=C2)=NC(\C=C\C2=CC=CC=C2)=N1
  5. Bafetinib; INNO-406

    CAS No.: 859212-16-1
    Catalog No.: 151421
    Purity: 95%
    MF: C30H31F3N8O
    MW: 576.627
    Storage: 2-8 degree Celsius
    SMILES: CN(C)[C@H]1CCN(CC2=C(C=C(C=C2)C(=O)NC2=CC(NC3=NC(=CC=N3)C3=CN=CN=C3)=C(C)C=C2)C(F)(F)F)C1
  6. 2-Methoxyestradiol; 2-MeOE2

    CAS No.: 362-07-2
    Catalog No.: 151396
    Purity: 95%
    MF: C19H26O3
    MW: 302.414
    Storage: 2-8 degree Celsius
    SMILES: [H][C@@]12CC[C@H](O)[C@@]1(C)CC[C@]1([H])C3=CC(OC)=C(O)C=C3CC[C@@]21[H]
  7. R788 (Fostamatinib) disodium

    CAS No.: 1025687-58-4
    Catalog No.: 141522
    Purity: 95%
    MF: C23H24FN6Na2O9P
    MW: 624.43
    Storage: 2-8 degree Celsius
    SMILES: [Na+].[Na+].COC1=CC(NC2=NC=C(F)C(NC3=CC=C4OC(C)(C)C(=O)N(COP([O-])([O-])=O)C4=N3)=N2)=CC(OC)=C1OC
  8. PF-00562271

    CAS No.: 939791-38-5
    Catalog No.: 141603
    Purity: 95%
    MF: C27H26F3N7O6S2
    MW: 665.676
    Storage: 2-8 degree Celsius
    SMILES: OS(=O)(=O)C1=CC=CC=C1.CN(C1=NC=CC=C1CNC1=NC(NC2=CC3=C(NC(=O)C3)C=C2)=NC=C1C(F)(F)F)S(C)(=O)=O
  9. KX2-391

    CAS No.: 897016-82-9
    Catalog No.: 141608
    Purity: 95%
    MF: C26H29N3O3
    MW: 431.536
    Storage: 2-8 degree Celsius
    SMILES: O=C(CC1=NC=C(C=C1)C1=CC=C(OCCN2CCOCC2)C=C1)NCC1=CC=CC=C1
  10. Dovitinib (TKI-258) dilactic acid

    CAS No.: 852433-84-2
    Catalog No.: 141616
    Purity: 95%
    MF: C27H33FN6O7
    MW: 572.594
    Storage: 2-8 degree Celsius
    SMILES: CC(O)C(O)=O.CC(O)C(O)=O.CN1CCN(CC1)C1=CC=C2N=C(NC2=C1)C1=C(N)C2=C(NC1=O)C=CC=C2F
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 87 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5