•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Angiogenesis

Set Ascending Direction

   

Items 21 to 26 of 26 total

  1. 1
  2. 2
  3. 3
  1. Entospletinib; GS-9973

    CAS No.: 1229208-44-9
    Catalog No.: 136524
    Purity: 95%
    MF: C23H21N7O
    MW: 411.469
    Storage: 2-8 degree Celsius
    SMILES: C1CN(CCO1)C1=CC=C(NC2=NC(=CN3C=CN=C23)C2=CC3=C(C=NN3)C=C2)C=C1
  2. PD-169316

    CAS No.: 152121-53-4
    Catalog No.: 106204
    Purity: 95%
    MF: C20H13FN4O2
    MW: 360.348
    Storage: 2-8 degree Celsius
    SMILES: [O-][N+](=O)C1=CC=C(C=C1)C1=NC(=C(N1)C1=CC=NC=C1)C1=CC=C(F)C=C1
  3. Molidustat; BAY 85-3934

    CAS No.: 1154028-82-6
    Catalog No.: 140527
    Purity: 95%
    MF: C13H14N8O2
    MW: 314.309
    Storage: 2-8 degree Celsius
    SMILES: O=C1N(NC=C1N1C=CN=N1)C1=CC(=NC=N1)N1CCOCC1
  4. GSK 2830371

    CAS No.: 1404456-53-6
    Catalog No.: 140503
    Purity: 95%
    MF: C23H29ClN4O2S
    MW: 461.031
    Storage: 2-8 degree Celsius
    SMILES: CC1=NC=C(Cl)C=C1NCC1=CC=C(S1)C(=O)N[C@@H](CC1CCCC1)C(=O)NC1CC1
  5. BLU 9931

    CAS No.: 1538604-68-0
    Catalog No.: 140473
    Purity: 95%
    MF: C26H22Cl2N4O3
    MW: 509.393
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC(OC)=C(Cl)C(=C1Cl)C1=CC=C2N=C(NC3=C(NC(=O)C=C)C=CC=C3C)N=CC2=C1
  6. R406

    CAS No.: 841290-81-1
    Catalog No.: 111912
    Purity: 95%
    MF: C28H29FN6O8S
    MW: 628.639
    Storage: 2-8 degree Celsius
    SMILES: OS(=O)(=O)C1=CC=CC=C1.COC1=CC(NC2=NC=C(F)C(NC3=CC=C4OC(C)(C)C(=O)NC4=N3)=N2)=CC(OC)=C1OC
Loading ...Load More ...
Set Ascending Direction

   

Items 21 to 26 of 26 total

  1. 1
  2. 2
  3. 3