•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Alkyls

Set Descending Direction

   

Items 1 to 10 of 2514 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 2,2-dimethylpropanethioamide

    CAS No.: 630-22-8
    Catalog No.: 100247
    Purity: 95%
    MF: C5H11NS
    MW: 117.217
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)C(N)=S
  2. ethyl 3-chloro-2,4-dioxopentanoate

    CAS No.: 34959-81-4
    Catalog No.: 100248
    Purity: 95%
    MF: C7H9ClO4
    MW: 192.598
    Storage: 2-8 degree Celsius
    SMILES: CCOC(=O)C(=O)C(Cl)C(C)=O
  3. (2R,3R)-diethyl 2-bromo-3-hydroxysuccinate

    CAS No.: 80640-15-9
    Catalog No.: 100251
    Purity: 95%
    MF: C8H13BrO5
    MW: 269.091
    Storage: 2-8 degree Celsius
  4. (E)-1-(2-tert-butylhydrazono)propan-2-one

    CAS No.: 83297-06-7
    Catalog No.: 100288
    Purity: 95%
    MF: C7H14N2O
    MW: 142.202
    Storage: 2-8 degree Celsius
  5. 2-((2-(trimethylsilyl)ethoxy)methoxy)propanoic acid

    CAS No.: 1035794-06-9
    Catalog No.: 100323
    Purity: 95%
    MF: C9H20O4Si
    MW: 220.341
    Storage: 2-8 degree Celsius
  6. 3,3,3-trifluoro-2,2-dimethylpropanoic acid

    CAS No.: 889940-13-0
    Catalog No.: 100341
    Purity: 95%
    MF: C5H7F3O2
    MW: 156.103
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C(O)=O)C(F)(F)F
  7. (1E,4Z)-5-hydroxy-1-methoxy-6,6-dimethylhepta-1,4-dien-3-one

    CAS No.: 74628-10-7
    Catalog No.: 100387
    Purity: 95%
    MF: C10H16O3
    MW: 184.235
    Storage: 2-8 degree Celsius
    SMILES: CO\C=C\C(=O)\C=C(/O)C(C)(C)C
  8. Boc-Lys-Ome

    CAS No.: 55757-60-3
    Catalog No.: 100708
    Purity: 95%
    MF: C12H24N2O4
    MW: 260.334
    Storage: 2-8 degree Celsius
    SMILES: COC(=O)[C@H](CCCCN)NC(=O)OC(C)(C)C
  9. O-(but-3-en-1-yl)hydroxylamine hydrochloride

    CAS No.: 113211-41-9
    Catalog No.: 100592
    Purity: 95%
    MF: C4H10ClNO
    MW: 123.583
    Storage: 2-8 degree Celsius
    SMILES: Cl[H].NOCCC=C
  10. tert-butyl 3-aminopropyl(isopropyl)carbamate

    CAS No.: 1111236-12-4
    Catalog No.: 100602
    Purity: 95%
    MF: C11H24N2O2
    MW: 216.325
    Storage: 2-8 degree Celsius
    SMILES: CC(C)N(CCCN)C(=O)OC(C)(C)C
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 2514 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5