•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Akt

Set Descending Direction

   

Items 1 to 10 of 29 total

  1. 1
  2. 2
  3. 3
  1. CCT128930

    CAS No.: 885499-61-6
    Catalog No.: 141600
    Purity: 95%
    MF: C18H20ClN5
    MW: 341.846
    Storage: 2-8 degree Celsius
    SMILES: NC1(CC2=CC=C(Cl)C=C2)CCN(CC1)C1=NC=NC2=C1C=CN2
  2. Borussertib

    CAS No.: 1800070-77-2
    Catalog No.: ZB1628
    Purity: 95%
    MF: C36H32N6O3
    MW: 596.691
    Storage: 2-8 degree Celsius
    SMILES: O=C1N(C2=C(N1)C=CC(=C2)NC(C=C)=O)C2CCN(CC2)CC2=CC=C(C=C2)C2=NC=1C=CNC(C1C=C2C2=CC=CC=C2)=O
  3. MKC-1

    CAS No.: 125313-92-0
    Catalog No.: WLZ0368
    Purity: 95%
    MF: C22H16N4O4
    MW: 400.394
    Storage: 2-8 degree Celsius
    SMILES: CN1C=C(C2=CC=CC=C12)C=1C(NC(C1C1=CN(C2=CC(=CC=C12)[N+](=O)[O-])C)=O)=O
  4. API-1 ; NSC177223

    CAS No.: 36707-00-3
    Catalog No.: 194607
    Purity: 95%
    MF: C13H15N5O6
    MW: 337.292
    Storage: 2-8 degree Celsius
    SMILES: NC=1C2=C(N=CN1)N(C=C(C2=O)C(=O)N)[C@@H]2O[C@@H]([C@H]([C@H]2O)O)CO
  5. Miransertib (ARQ 092) HCl

    CAS No.: 1313883-00-9
    Catalog No.: 193774
    Purity: 95%
    MF: C27H25ClN6
    MW: 468.992
    Storage: 2-8 degree Celsius
    SMILES: Cl.NC1(CCC1)C1=CC=C(C=C1)N1C(=NC=2C1=NC(=CC2)C2=CC=CC=C2)C=2C(=NC=CC2)N
  6. SC66

    CAS No.: 871361-88-5
    Catalog No.: 169460
    Purity: 95%
    MF: C18H16N2O
    MW: 276.339
    Storage: 2-8 degree Celsius
    SMILES: O=C1\C(CCC\C1=C/C1=CC=NC=C1)=C\C1=CC=NC=C1
  7. PQR-309

    CAS No.: 1225037-39-7
    Catalog No.: 153258
    Purity: 95%
    MF: C17H20F3N7O2
    MW: 411.388
    Storage: 2-8 degree Celsius
    SMILES: NC1=NC=C(C2=NC(=NC(=N2)N2CCOCC2)N2CCOCC2)C(=C1)C(F)(F)F
  8. Loureirin A

    CAS No.: 119425-89-7
    Catalog No.: ZB1869
    Purity: 95%
    MF: C17H18O4
    MW: 286.327
    Storage: 2-8 degree Celsius
    SMILES: COC1=C(C=CC(=C1)OC)CCC(=O)C1=CC=C(C=C1)O
  9. ARQ-092

    CAS No.: 1313881-70-7
    Catalog No.: 186224
    Purity: 95%
    MF: C27H24N6
    MW: 432.531
    Storage: 2-8 degree Celsius
    SMILES: NC1(CCC1)C1=CC=C(C=C1)N1C(=NC=2C1=NC(=CC2)C2=CC=CC=C2)C=2C(=NC=CC2)N
  10. SC79

    CAS No.: 305834-79-1
    Catalog No.: 152104
    Purity: 95%
    MF: C17H17ClN2O5
    MW: 364.785
    Storage: 2-8 degree Celsius
    SMILES: CCOC(=O)C(C#N)C1C2=CC(Cl)=CC=C2OC(N)=C1C(=O)OCC
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 29 total

  1. 1
  2. 2
  3. 3