•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Adrenergic Receptor

Set Descending Direction

   

Items 1 to 10 of 86 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. Clorprenaline HCl

    CAS No.: 6933-90-0
    Catalog No.: 151884
    Purity: 95%
    MF: C11H17Cl2NO
    MW: 250.169
    Storage: 2-8 degree Celsius
    SMILES: Cl.CC(C)NCC(O)C1=C(Cl)C=CC=C1
  2. Terbutaline Sulfate

    CAS No.: 23031-32-5
    Catalog No.: 151882
    Purity: 95%
    MF: C24H40N2O10S
    MW: 548.655
    Storage: 2-8 degree Celsius
    SMILES: OS(O)(=O)=O.CC(C)(C)NCC(O)C1=CC(O)=CC(O)=C1.CC(C)(C)NCC(O)C1=CC(O)=CC(O)=C1
  3. Synephrine

    CAS No.: 94-07-5
    Catalog No.: 151652
    Purity: 95%
    MF: C9H13NO2
    MW: 167.208
    Storage: 2-8 degree Celsius
    SMILES: CNCC(O)C1=CC=C(O)C=C1
  4. Noradrenaline bitartrate monohydrate

    CAS No.: 108341-18-0
    Catalog No.: 151750
    Purity: 95%
    MF: C12H19NO10
    MW: 337.281
    Storage: 2-8 degree Celsius
    SMILES: [H]O[H].O[C@H]([C@@H](O)C(O)=O)C(O)=O.NC[C@H](O)C1=CC=C(O)C(O)=C1
  5. Mirabegron

    CAS No.: 223673-61-8
    Catalog No.: 151847
    Purity: 95%
    MF: C21H24N4O2S
    MW: 396.516
    Storage: 2-8 degree Celsius
    SMILES: NC1=NC(CC(=O)NC2=CC=C(CCNC[C@H](O)C3=CC=CC=C3)C=C2)=CS1
  6. Levobetaxolol HCl

    CAS No.: 116209-55-3
    Catalog No.: 151868
    Purity: 95%
    MF: C18H30ClNO3
    MW: 343.895
    Storage: 2-8 degree Celsius
    SMILES: Cl.CC(C)NC[C@H](O)COC1=CC=C(CCOCC2CC2)C=C1
  7. L755,507

    CAS No.: 159182-43-1
    Catalog No.: 152138
    Purity: 95%
    MF: C30H40N4O6S
    MW: 584.739
    Storage: 2-8 degree Celsius
    SMILES: CCCCCCNC(=O)NC1=CC=C(C=C1)S(=O)(=O)NC1=CC=C(CCNC[C@H](O)COC2=CC=C(O)C=C2)C=C1
  8. Indacaterol Maleate

    CAS No.: 753498-25-8
    Catalog No.: 151818
    Purity: 95%
    MF: C28H32N2O7
    MW: 508.571
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)\C=C/C(O)=O.CCC1=CC2=C(CC(C2)NC[C@H](O)C2=CC=C(O)C3=C2C=CC(=O)N3)C=C1CC
  9. Epinephrine HCl

    CAS No.: 55-31-2
    Catalog No.: 151807
    Purity: 95%
    MF: C9H14ClNO3
    MW: 219.668
    Storage: 2-8 degree Celsius
    SMILES: Cl.CNC[C@H](O)C1=CC(O)=C(O)C=C1
  10. Droxidopa

    CAS No.: 23651-95-8
    Catalog No.: 151799
    Purity: 95%
    MF: C9H11NO5
    MW: 213.189
    Storage: 2-8 degree Celsius
    SMILES: N[C@@H]([C@H](O)C1=CC(O)=C(O)C=C1)C(O)=O
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 86 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5