•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

AChR

Set Descending Direction

   

Items 31 to 40 of 44 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. Neostigmine Bromide

    CAS No.: 114-80-7
    Catalog No.: 141570
    Purity: 95%
    MF: C12H19BrN2O2
    MW: 303.2
    Storage: 2-8 degree Celsius
    SMILES: [Br-].CN(C)C(=O)OC1=CC=CC(=C1)[N+](C)(C)C
  2. Orphenadrine Citrate

    CAS No.: 4682-36-4
    Catalog No.: 141499
    Purity: 95%
    MF: C24H31NO8
    MW: 461.511
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)CC(O)(CC(O)=O)C(O)=O.CN(C)CCOC(C1=CC=CC=C1)C1=CC=CC=C1C
  3. Otilonium Bromide

    CAS No.: 26095-59-0
    Catalog No.: 141647
    Purity: 95%
    MF: C29H43BrN2O4
    MW: 563.577
    Storage: 2-8 degree Celsius
    SMILES: [Br-].CCCCCCCCOC1=C(C=CC=C1)C(=O)NC1=CC=C(C=C1)C(=O)OCC[N+](C)(CC)CC
  4. Fesoterodine Fumarate

    CAS No.: 286930-03-8
    Catalog No.: 102658
    Purity: 95%
    MF: C30H41NO7
    MW: 527.658
    Storage: 2-8 degree Celsius
  5. Pentoxyverine Citrate

    CAS No.: 23142-01-0
    Catalog No.: 141726
    Purity: 95%
    MF: C26H36NO10-3
    MW: 522.571
    Storage: 2-8 degree Celsius
    SMILES: OC(CC([O-])=O)(CC([O-])=O)C([O-])=O.CCN(CC)CCOCCOC(=O)C1(CCCC1)C1=CC=CC=C1
  6. Pyridostigmine Bromide

    CAS No.: 101-26-8
    Catalog No.: 141412
    Purity: 95%
    MF: C9H13BrN2O2
    MW: 261.119
    Storage: 2-8 degree Celsius
    SMILES: [Br-].CN(C)C(=O)OC1=CC=C[N+](C)=C1
  7. Tropicamide

    CAS No.: 1508-75-4
    Catalog No.: 141473
    Purity: 95%
    MF: C17H20N2O2
    MW: 284.359
    Storage: 2-8 degree Celsius
    SMILES: CCN(CC1=CC=NC=C1)C(=O)C(CO)C1=CC=CC=C1
  8. Galanthamine HBr

    CAS No.: 1953-04-4
    Catalog No.: 151415
    Purity: 95%
    MF: C17H22BrNO3
    MW: 368.271
    Storage: 2-8 degree Celsius
    SMILES: Br[H].[H][C@]12C[C@@H](O)C=C[C@]11CCN(C)CC3=CC=C(OC)C(O2)=C13
  9. Ipratropium Bromide

    CAS No.: 22254-24-6
    Catalog No.: 151484
    Purity: 95%
    MF: C20H30BrNO3
    MW: 412.368
    Storage: 2-8 degree Celsius
    SMILES: [Br-].CC(C)[N@@+]1(C)C2CC[C@H]1C[C@H](C2)OC(=O)C(CO)C1=CC=CC=C1
  10. Methscopolamine

    CAS No.: 155-41-9
    Catalog No.: 151550
    Purity: 95%
    MF: C18H24BrNO4
    MW: 398.297
    Storage: 2-8 degree Celsius
    SMILES: [Br-].C[N+]1(C)C2C[C@H](CC1[C@@H]1O[C@H]21)OC(=O)[C@H](CO)C1=CC=CC=C1
Loading ...Load More ...
Set Descending Direction

   

Items 31 to 40 of 44 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5