•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

AChR

Set Descending Direction

   

Items 1 to 10 of 44 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. Pilocarpine HCl

    CAS No.: 54-71-7
    Catalog No.: 151913
    Purity: 95%
    MF: C11H17ClN2O2
    MW: 244.722
    Storage: 2-8 degree Celsius
    SMILES: Cl.CC[C@H]1[C@@H](CC2=CN=CN2C)COC1=O
  2. Amfebutamone (Bupropion) HCl

    CAS No.: 31677-93-7
    Catalog No.: 151690
    Purity: 95%
    MF: C13H19Cl2NO
    MW: 276.207
    Storage: 2-8 degree Celsius
    SMILES: Cl.CC(NC(C)(C)C)C(=O)C1=CC(Cl)=CC=C1
  3. Darifenacin HBr

    CAS No.: 133099-07-7
    Catalog No.: 151824
    Purity: 95%
    MF: C28H31BrN2O2
    MW: 507.472
    Storage: 2-8 degree Celsius
    SMILES: Br.NC(=O)C([C@@H]1CCN(CCC2=CC3=C(OCC3)C=C2)C1)(C1=CC=CC=C1)C1=CC=CC=C1
  4. Decamethonium Bromide

    CAS No.: 541-22-0
    Catalog No.: 151866
    Purity: 95%
    MF: C16H38Br2N2
    MW: 418.302
    Storage: 2-8 degree Celsius
    SMILES: [Br-].[Br-].C[N+](C)(C)CCCCCCCCCC[N+](C)(C)C
  5. Donepezil HCl

    CAS No.: 120011-70-3
    Catalog No.: 151694
    Purity: 95%
    MF: C24H30ClNO3
    MW: 415.961
    Storage: 2-8 degree Celsius
    SMILES: Cl.COC1=C(OC)C=C2C(=O)C(CC3CCN(CC4=CC=CC=C4)CC3)CC2=C1
  6. Gallamine Triethiodide

    CAS No.: 65-29-2
    Catalog No.: 151696
    Purity: 95%
    MF: C30H60I3N3O3
    MW: 891.54
    Storage: 2-8 degree Celsius
    SMILES: [I-].[I-].[I-].CC[N+](CC)(CC)CCOC1=CC=CC(OCC[N+](CC)(CC)CC)=C1OCC[N+](CC)(CC)CC
  7. Hexamethonium Bromide

    CAS No.: 55-97-0
    Catalog No.: 151864
    Purity: 95%
    MF: C12H30Br2N2
    MW: 362.194
    Storage: 2-8 degree Celsius
    SMILES: [Br-].[Br-].C[N+](C)(C)CCCCCC[N+](C)(C)C
  8. Homatropine Bromide

    CAS No.: 51-56-9
    Catalog No.: 151852
    Purity: 95%
    MF: C16H22BrNO3
    MW: 356.26
    Storage: 2-8 degree Celsius
    SMILES: Br.CN1[C@H]2CC[C@@H]1C[C@@H](C2)OC(=O)C(O)C1=CC=CC=C1
  9. Homatropine Methylbromide

    CAS No.: 80-49-9
    Catalog No.: 151851
    Purity: 95%
    MF: C17H24BrNO3
    MW: 370.287
    Storage: 2-8 degree Celsius
    SMILES: [Br-].C[N+]1(C)[C@H]2CC[C@@H]1C[C@@H](C2)OC(=O)C(O)C1=CC=CC=C1
  10. Nitenpyram

    CAS No.: 150824-47-8
    Catalog No.: 151931
    Purity: 95%
    MF: C11H15ClN4O2
    MW: 270.72
    Storage: 2-8 degree Celsius
    SMILES: CCN(CC1=CC=C(Cl)N=C1)C(\NC)=C\[N+]([O-])=O
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 44 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5