•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

AChR

Set Ascending Direction

   

Items 11 to 20 of 44 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. Paroxetine HCl

    CAS No.: 78246-49-8
    Catalog No.: 151790
    Purity: 95%
    MF: C19H21ClFNO3
    MW: 365.832
    Storage: 2-8 degree Celsius
    SMILES: Cl.FC1=CC=C(C=C1)[C@@H]1CCNC[C@H]1COC1=CC2=C(OCO2)C=C1
  2. Aclidinium Bromide

    CAS No.: 320345-99-1
    Catalog No.: 151853
    Purity: 95%
    MF: C26H30BrNO4S2
    MW: 564.567
    Storage: 2-8 degree Celsius
    SMILES: [Br-].OC(C(=O)O[C@H]1C[N+]2(CCCOC3=CC=CC=C3)CCC1CC2)(C1=CC=CS1)C1=CC=CS1
  3. PNU-120596

    CAS No.: 501925-31-1
    Catalog No.: 151751
    Purity: 95%
    MF: C13H14ClN3O4
    MW: 311.725
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC(OC)=C(NC(=O)NC2=NOC(C)=C2)C=C1Cl
  4. Scopolamine HBr

    CAS No.: 114-49-8
    Catalog No.: 151707
    Purity: 95%
    MF: C17H22BrNO4
    MW: 384.27
    Storage: 2-8 degree Celsius
    SMILES: Br[H].CN1[C@H]2C[C@@H](C[C@@H]1[C@H]1O[C@@H]21)OC(=O)[C@H](CO)C1=CC=CC=C1
  5. Solifenacin succinate

    CAS No.: 242478-38-2
    Catalog No.: 151802
    Purity: 95%
    MF: C27H32N2O6
    MW: 480.561
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)CCC(O)=O.O=C(O[C@H]1CN2CCC1CC2)N1CCC2=C(C=CC=C2)[C@@H]1C1=CC=CC=C1
  6. Tiotropium Bromide hydrate

    CAS No.: 139404-48-1
    Catalog No.: 151723
    Purity: 95%
    MF: C19H24BrNO5S2
    MW: 490.441
    Storage: 2-8 degree Celsius
    SMILES: O.[Br-].C[N+]1(C)[C@H]2C[C@H](C[C@@H]1[C@H]1O[C@@H]21)OC(=O)C(O)(C1=CC=CS1)C1=CC=CS1
  7. Tolterodine tartrate

    CAS No.: 124937-52-6
    Catalog No.: 151725
    Purity: 95%
    MF: C26H37NO7
    MW: 475.582
    Storage: 2-8 degree Celsius
    SMILES: O[C@H]([C@@H](O)C(O)=O)C(O)=O.CC(C)N(CC[C@H](C1=CC=CC=C1)C1=CC(C)=CC=C1O)C(C)C
  8. Trihexyphenidyl hydrochloride

    CAS No.: 52-49-3
    Catalog No.: 151939
    Purity: 95%
    MF: C20H32ClNO
    MW: 337.935
    Storage: 2-8 degree Celsius
    SMILES: Cl.OC(CCN1CCCCC1)(C1CCCCC1)C1=CC=CC=C1
  9. Trospium chloride

    CAS No.: 10405-02-4
    Catalog No.: 151724
    Purity: 95%
    MF: C25H30ClNO3
    MW: 427.972
    Storage: 2-8 degree Celsius
    SMILES: [Cl-].[H][C@]12CC[C@]([H])(C[C@@H](C1)OC(=O)C(O)(C1=CC=CC=C1)C1=CC=CC=C1)[N+]21CCCC1
  10. Scopolamine HBr trihydrate

    CAS No.: 6533-68-2
    Catalog No.: 191512
    Purity: 95%
    MF: C17H28BrNO7
    MW: 438.315
    Storage: 2-8 degree Celsius
    SMILES: [C@]([H])12O[C@@]1([H])[C@]([H])1N(C)[C@]2([H])C[C@@H](OC(=O)[C@H](CO)C2C=CC=CC=2)C1.O.O.O.Br
Loading ...Load More ...
Set Ascending Direction

   

Items 11 to 20 of 44 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5