•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Anthracenes

Set Descending Direction

   

Items 1 to 10 of 25 total

  1. 1
  2. 2
  3. 3
  1. 9-anthracenemethanol

    CAS No.: 1468-95-7
    Catalog No.: 101725
    Purity: 95%
    MF: C15H12O
    MW: 208.26
    Storage: 2-8 degree Celsius
    SMILES: OCC1=C2C=CC=CC2=CC2=CC=CC=C12
  2. 9-phenylanthracene

    CAS No.: 602-55-1
    Catalog No.: 108136
    Purity: 95%
    MF: C20H14
    MW: 254.332
    Storage: 2-8 degree Celsius
    SMILES: C1=CC=C(C=C1)C1=C2C=CC=CC2=CC2=CC=CC=C12
  3. phenanthrene-4,5-dicarboxylic acid

    CAS No.: 5462-82-8
    Catalog No.: 194879
    Purity: 95%
    MF: C16H10O4
    MW: 266.252
    Storage: 2-8 degree Celsius
    SMILES: C1=CC=C(C2=C3C(=CC=CC3=CC=C12)C(=O)O)C(=O)O
  4. 2-bromoanthracene-9,10-dione

    CAS No.: 572-83-8
    Catalog No.: 105605
    Purity: 95%
    MF: C14H7BrO2
    MW: 287.112
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=C2C(=O)C3=C(C=CC=C3)C(=O)C2=C1
  5. (10-phenylanthracen-9-yl)boronic acid

    CAS No.: 334658-75-2
    Catalog No.: 105232
    Purity: 95%
    MF: C20H15BO2
    MW: 298.15
    Storage: 2-8 degree Celsius
    SMILES: OB(O)C1=C2C=CC=CC2=C(C2=CC=CC=C2)C2=CC=CC=C12
  6. anthracene-2-carboxylic acid

    CAS No.: 613-08-1
    Catalog No.: 108140
    Purity: 95%
    MF: C15H10O2
    MW: 222.243
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C1=CC=C2C=C3C=CC=CC3=CC2=C1
  7. 2-(10-bromoanthracen-9-yl)thiophene

    CAS No.: 689254-82-8
    Catalog No.: 183830
    Purity: 95%
    MF: C18H11BrS
    MW: 339.257
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C2C=CC=CC2=C(C2=CC=CS2)C2=CC=CC=C12
  8. anthracen-2-ylmethanol

    CAS No.: 22863-82-7
    Catalog No.: 150990
    Purity: 95%
    MF: C15H12O
    MW: 208.26
    Storage: 2-8 degree Celsius
    SMILES: OCC1=CC2=CC3=CC=CC=C3C=C2C=C1
  9. 9,10-dioxo-8a,9,10,10a-tetrahydroanthracene-2-carboxylic acid

    CAS No.: 117-78-2
    Catalog No.: 150989
    Purity: 95%
    MF: C15H10O4
    MW: 254.241
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C1=CC=C2C(=O)C3C=CC=CC3C(=O)C2=C1
  10. anthracene-2-carbaldehyde

    CAS No.: 2143-81-9
    Catalog No.: 135417
    Purity: 95%
    MF: C15H10O
    MW: 206.244
    Storage: 2-8 degree Celsius
    SMILES: O=CC1=CC2=CC3=CC=CC=C3C=C2C=C1
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 25 total

  1. 1
  2. 2
  3. 3