2-amino-5-iodo-3-nitrobenzoic acid
$540.00
CAS No.: 1153949-03-1
Catalog No.: 185241
Purity: 95%
MF: C7H5IN2O4
MW: 308.031
Storage: 2-8 degree Celsius
SMILES: NC1=C(C=C(I)C=C1[N+]([O-])=O)C(O)=O
Catalog No.: 185241
Purity: 95%
MF: C7H5IN2O4
MW: 308.031
Storage: 2-8 degree Celsius
SMILES: NC1=C(C=C(I)C=C1[N+]([O-])=O)C(O)=O
For R&D use only. Not for human or animal use.
2-amino-5-iodo-3-nitrobenzoic acid; CAS No.: 1153949-03-1; ChemShuttle operates as a custom chemical synthesis company, offering heterocycles such as 2-amino-5-iodo-3-nitrobenzoic acid. This nitro-substituted benzoic acid derivative is valuable in medicinal chemistry for its reactivity and potential in constructing bioactive molecules. The company s CRO chemical synthesis services ensure reliable and scalable production for research and development needs.
Reviews
Write Your Own Review